C11H17F3N2O2 — CID 64902187
3,3,6,6-tetramethyl-1-(3,3,3-trifluoropropyl)piperazine-2,5-dione (PubChem CID 64902187) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1-(3,3,3-trifluoropropyl)piperazine-2,5-dione.
| Compound Name | 3,3,6,6-tetramethyl-1-(3,3,3-trifluoropropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64902187 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3,3,6,6-tetramethyl-1-(3,3,3-trifluoropropyl)piperazine-2,5-dione |
| SMILES | CC1(C)NC(=O)C(C)(C)N(CCC(F)(F)F)C1=O |
| InChI | InChI=1S/C11H17F3N2O2/c1-9(2)8(18)16(6-5-11(12,13)14)10(3,4)7(17)15-9/h5-6H2,1-4H3,(H,15,17) |
| InChIKey | XLAWFTNYPWZFTH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |