C12H22N2O2S — CID 113474635
3,3,6,6-tetramethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione (PubChem CID 113474635) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione.
| Compound Name | 3,3,6,6-tetramethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 113474635 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3,3,6,6-tetramethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione |
| SMILES | CSCCCN1C(=O)C(C)(C)NC(=O)C1(C)C |
| InChI | InChI=1S/C12H22N2O2S/c1-11(2)10(16)14(7-6-8-17-5)12(3,4)9(15)13-11/h6-8H2,1-5H3,(H,13,15) |
| InChIKey | OJOJQIYWCLDUCH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|