C17H24N2O2 — CID 64880416
1-butyl-3,6,6-trimethyl-3-phenylpiperazine-2,5-dione (PubChem CID 64880416) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-butyl-3,6,6-trimethyl-3-phenylpiperazine-2,5-dione.
| Compound Name | 1-butyl-3,6,6-trimethyl-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64880416 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-butyl-3,6,6-trimethyl-3-phenylpiperazine-2,5-dione |
| SMILES | CCCCN1C(=O)C(C)(c2ccccc2)NC(=O)C1(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-5-6-12-19-15(21)17(4,13-10-8-7-9-11-13)18-14(20)16(19,2)3/h7-11H,5-6,12H2,1-4H3,(H,18,20) |
| InChIKey | XJUDJVDZDXGXIK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |