C20H22N2S — CID 110192395
3-butyl-2-methyl-2,5-diphenylimidazole-4-thione (PubChem CID 110192395) has the molecular formula C20H22N2S and a molecular weight of 322.48 g/mol. Its IUPAC name is 3-butyl-2-methyl-2,5-diphenylimidazole-4-thione.
| Compound Name | 3-butyl-2-methyl-2,5-diphenylimidazole-4-thione |
|---|---|
| PubChem CID | 110192395 |
| Molecular Formula | C20H22N2S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-butyl-2-methyl-2,5-diphenylimidazole-4-thione |
| SMILES | CCCCN1C(=S)C(c2ccccc2)=NC1(C)c1ccccc1 |
| InChI | InChI=1S/C20H22N2S/c1-3-4-15-22-19(23)18(16-11-7-5-8-12-16)21-20(22,2)17-13-9-6-10-14-17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | GNQXDTVEIIPXEV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|