C15H13N3S — CID 135577923
3-methyl-5-phenyl-1H-1,3,4-benzotriazepine-2-thione (PubChem CID 135577923) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 3-methyl-5-phenyl-1H-1,3,4-benzotriazepine-2-thione.
| Compound Name | 3-methyl-5-phenyl-1H-1,3,4-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 135577923 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-methyl-5-phenyl-1H-1,3,4-benzotriazepine-2-thione |
| SMILES | CN1N=C(c2ccccc2)c2ccccc2NC1=S |
| InChI | InChI=1S/C15H13N3S/c1-18-15(19)16-13-10-6-5-9-12(13)14(17-18)11-7-3-2-4-8-11/h2-10H,1H3,(H,16,19) |
| InChIKey | XNOPFQRIRRKTBZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|