C17H18N3O+ — CID 12534713
(5Z)-4,4-dimethyl-6-phenyl-1,3-dihydro-1,4,5-benzotriazocin-4-ium-2-one (PubChem CID 12534713) has the molecular formula C17H18N3O+ and a molecular weight of 280.35 g/mol. Its IUPAC name is (5Z)-4,4-dimethyl-6-phenyl-1,3-dihydro-1,4,5-benzotriazocin-4-ium-2-one.
| Compound Name | (5Z)-4,4-dimethyl-6-phenyl-1,3-dihydro-1,4,5-benzotriazocin-4-ium-2-one |
|---|---|
| PubChem CID | 12534713 |
| Molecular Formula | C17H18N3O+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (5Z)-4,4-dimethyl-6-phenyl-1,3-dihydro-1,4,5-benzotriazocin-4-ium-2-one |
| SMILES | C[N+]1(C)CC(=O)Nc2ccccc2/C(c2ccccc2)=N\1 |
| InChI | InChI=1S/C17H17N3O/c1-20(2)12-16(21)18-15-11-7-6-10-14(15)17(19-20)13-8-4-3-5-9-13/h3-11H,12H2,1-2H3/p+1 |
| InChIKey | SAMUMFMNEHULQA-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|