C21H25ClN4S — CID 135765352
7-chloro-3-[3-(diethylamino)propyl]-5-phenyl-1H-1,3,4-benzotriazepine-2-thione (PubChem CID 135765352) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is 7-chloro-3-[3-(diethylamino)propyl]-5-phenyl-1H-1,3,4-benzotriazepine-2-thione.
| Compound Name | 7-chloro-3-[3-(diethylamino)propyl]-5-phenyl-1H-1,3,4-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 135765352 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 7-chloro-3-[3-(diethylamino)propyl]-5-phenyl-1H-1,3,4-benzotriazepine-2-thione |
| SMILES | CCN(CC)CCCN1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=S |
| InChI | InChI=1S/C21H25ClN4S/c1-3-25(4-2)13-8-14-26-21(27)23-19-12-11-17(22)15-18(19)20(24-26)16-9-6-5-7-10-16/h5-7,9-12,15H,3-4,8,13-14H2,1-2H3,(H,23,27) |
| InChIKey | KHBNIUFCIKCNNX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|