C16H19N3O3 — CID 6490336
3-hydroxy-N-(8-methyl-4-oxo-1H-quinolin-3-yl)piperidine-1-carboxamide (PubChem CID 6490336) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-hydroxy-N-(8-methyl-4-oxo-1H-quinolin-3-yl)piperidine-1-carboxamide.
| Compound Name | 3-hydroxy-N-(8-methyl-4-oxo-1H-quinolin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 6490336 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-hydroxy-N-(8-methyl-4-oxo-1H-quinolin-3-yl)piperidine-1-carboxamide |
| SMILES | Cc1cccc2c(=O)c(NC(=O)N3CCCC(O)C3)c[nH]c12 |
| InChI | InChI=1S/C16H19N3O3/c1-10-4-2-6-12-14(10)17-8-13(15(12)21)18-16(22)19-7-3-5-11(20)9-19/h2,4,6,8,11,20H,3,5,7,9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | ZNNCJYBCYPUFHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |