C13H12BrNO3S — CID 64905786
2-(3-bromophenyl)-3-(1,1-dioxothiolan-3-yl)-3-oxopropanenitrile (PubChem CID 64905786) has the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(1,1-dioxothiolan-3-yl)-3-oxopropanenitrile.
| Compound Name | 2-(3-bromophenyl)-3-(1,1-dioxothiolan-3-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 64905786 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-(3-bromophenyl)-3-(1,1-dioxothiolan-3-yl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)C1CCS(=O)(=O)C1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H12BrNO3S/c14-11-3-1-2-9(6-11)12(7-15)13(16)10-4-5-19(17,18)8-10/h1-3,6,10,12H,4-5,8H2 |
| InChIKey | LAFGIWGHBRVWJI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |