C8H11NO3S — CID 64905584
3-(1,1-dioxothiolan-3-yl)-2-methyl-3-oxopropanenitrile (PubChem CID 64905584) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-2-methyl-3-oxopropanenitrile.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-2-methyl-3-oxopropanenitrile |
|---|---|
| PubChem CID | 64905584 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-2-methyl-3-oxopropanenitrile |
| SMILES | CC(C#N)C(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H11NO3S/c1-6(4-9)8(10)7-2-3-13(11,12)5-7/h6-7H,2-3,5H2,1H3 |
| InChIKey | ZHOJTEPSPQMYRA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|