C20H22N6O3 — CID 649082
N-[2-[2-[2-(cyclohexylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide (PubChem CID 649082) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[2-[2-[2-(cyclohexylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[2-(cyclohexylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 649082 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[2-[2-[2-(cyclohexylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2NC(=O)c2ccco2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C20H22N6O3/c27-18(21-14-7-2-1-3-8-14)13-26-24-19(23-25-26)15-9-4-5-10-16(15)22-20(28)17-11-6-12-29-17/h4-6,9-12,14H,1-3,7-8,13H2,(H,21,27)(H,22,28) |
| InChIKey | WSVGLRBNXBJKLR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |