C21H17N5O4 — CID 656033
N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide (PubChem CID 656033) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 656033 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[2-[2-[2-(4-methoxyphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)Cn2nnc(-c3ccccc3NC(=O)c3ccco3)n2)cc1 |
| InChI | InChI=1S/C21H17N5O4/c1-29-15-10-8-14(9-11-15)18(27)13-26-24-20(23-25-26)16-5-2-3-6-17(16)22-21(28)19-7-4-12-30-19/h2-12H,13H2,1H3,(H,22,28) |
| InChIKey | XBUZPCJNKXXPQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |