C22H20N6O4 — CID 1452563
N-[4-[2-[2-(furan-2-ylmethylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-2-methoxybenzamide (PubChem CID 1452563) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is N-[4-[2-[2-(furan-2-ylmethylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-[2-[2-(furan-2-ylmethylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 1452563 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[4-[2-[2-(furan-2-ylmethylamino)-2-oxoethyl]tetrazol-5-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(-c2nnn(CC(=O)NCc3ccco3)n2)cc1 |
| InChI | InChI=1S/C22H20N6O4/c1-31-19-7-3-2-6-18(19)22(30)24-16-10-8-15(9-11-16)21-25-27-28(26-21)14-20(29)23-13-17-5-4-12-32-17/h2-12H,13-14H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | NZJHHLLTJRLKHY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |