C10H13NO4 — CID 64911371
N-(3-hydroxybutyl)-6-oxopyran-3-carboxamide (PubChem CID 64911371) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-6-oxopyran-3-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 64911371 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-(3-hydroxybutyl)-6-oxopyran-3-carboxamide |
| SMILES | CC(O)CCNC(=O)c1ccc(=O)oc1 |
| InChI | InChI=1S/C10H13NO4/c1-7(12)4-5-11-10(14)8-2-3-9(13)15-6-8/h2-3,6-7,12H,4-5H2,1H3,(H,11,14) |
| InChIKey | SETGKGLKJPULTA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |