About N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide
N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 111433796) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 111433796 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | CC(O)CCNC(=O)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C13H16N4O2/c1-10(18)6-7-14-13(19)11-2-4-12(5-3-11)17-8-15-16-9-17/h2-5,8-10,18H,6-7H2,1H3,(H,14,19) |
| InChIKey | DBYRUVFACLZWGN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide (CID 111433796) is N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide is CC(O)CCNC(=O)c1ccc(-n2cnnc2)cc1.
What is the InChIKey of N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is DBYRUVFACLZWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-10(18)6-7-14-13(19)11-2-4-12(5-3-11)17-8-15-16-9-17/h2-5,8-10,18H,6-7H2,1H3,(H,14,19).
What are the key properties of N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide?
N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 260.30 g/mol, XLogP of 0.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxybutyl)-4-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 111433796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).