C24H26ClN3O2 — CID 6491138
4-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one (PubChem CID 6491138) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 4-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 6491138 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1CC(c2nc3ccccc3n2CCCCOc2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C24H26ClN3O2/c1-2-13-27-17-18(16-23(27)29)24-26-21-7-3-4-8-22(21)28(24)14-5-6-15-30-20-11-9-19(25)10-12-20/h2-4,7-12,18H,1,5-6,13-17H2 |
| InChIKey | DMVPLLODPYNUCR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|