C9H11BrO3S — CID 64914473
3-[(5-bromofuran-2-yl)methylsulfanyl]-2-methylpropanoic acid (PubChem CID 64914473) has the molecular formula C9H11BrO3S and a molecular weight of 279.15 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 3-[(5-bromofuran-2-yl)methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64914473 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(CSCc1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C9H11BrO3S/c1-6(9(11)12)4-14-5-7-2-3-8(10)13-7/h2-3,6H,4-5H2,1H3,(H,11,12) |
| InChIKey | YUGHSNWXNFRYDQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |