C11H16BrNO3 — CID 82344547
2-[(5-bromofuran-2-yl)methylamino]-3-methylpentanoic acid (PubChem CID 82344547) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(5-bromofuran-2-yl)methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 82344547 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NCc1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C11H16BrNO3/c1-3-7(2)10(11(14)15)13-6-8-4-5-9(12)16-8/h4-5,7,10,13H,3,6H2,1-2H3,(H,14,15) |
| InChIKey | SBWIRHZWDBTQSA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |