C10H13Br2NO3 — CID 62084674
2-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbutanoic acid (PubChem CID 62084674) has the molecular formula C10H13Br2NO3 and a molecular weight of 355.03 g/mol. Its IUPAC name is 2-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 62084674 |
| Molecular Formula | C10H13Br2NO3 |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | 2-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NCc1cc(Br)c(Br)o1)C(=O)O |
| InChI | InChI=1S/C10H13Br2NO3/c1-5(2)8(10(14)15)13-4-6-3-7(11)9(12)16-6/h3,5,8,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | DPUPNULRBAVDIR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |