C14H26N2O4 — CID 64915037
2-[(3-ethyl-2-methylcyclopentyl)carbamoylamino]-4-methoxybutanoic acid (PubChem CID 64915037) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[(3-ethyl-2-methylcyclopentyl)carbamoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[(3-ethyl-2-methylcyclopentyl)carbamoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 64915037 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[(3-ethyl-2-methylcyclopentyl)carbamoylamino]-4-methoxybutanoic acid |
| SMILES | CCC1CCC(NC(=O)NC(CCOC)C(=O)O)C1C |
| InChI | InChI=1S/C14H26N2O4/c1-4-10-5-6-11(9(10)2)15-14(19)16-12(13(17)18)7-8-20-3/h9-12H,4-8H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | HFFIXYYVUMXGNP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |