C13H22F3N — CID 64917573
N-(1-cyclopropylpropyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64917573) has the molecular formula C13H22F3N and a molecular weight of 249.32 g/mol. Its IUPAC name is N-(1-cyclopropylpropyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(1-cyclopropylpropyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64917573 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-(1-cyclopropylpropyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCC(NC1CCCC(C(F)(F)F)C1)C1CC1 |
| InChI | InChI=1S/C13H22F3N/c1-2-12(9-6-7-9)17-11-5-3-4-10(8-11)13(14,15)16/h9-12,17H,2-8H2,1H3 |
| InChIKey | QNFQVJOVAGHAPL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |