C17H26BrNO — CID 64920939
4-bromo-2-[1-[(3-ethyl-2-methylcyclopentyl)amino]propyl]phenol (PubChem CID 64920939) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 4-bromo-2-[1-[(3-ethyl-2-methylcyclopentyl)amino]propyl]phenol.
| Compound Name | 4-bromo-2-[1-[(3-ethyl-2-methylcyclopentyl)amino]propyl]phenol |
|---|---|
| PubChem CID | 64920939 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-bromo-2-[1-[(3-ethyl-2-methylcyclopentyl)amino]propyl]phenol |
| SMILES | CCC(NC1CCC(CC)C1C)c1cc(Br)ccc1O |
| InChI | InChI=1S/C17H26BrNO/c1-4-12-6-8-16(11(12)3)19-15(5-2)14-10-13(18)7-9-17(14)20/h7,9-12,15-16,19-20H,4-6,8H2,1-3H3 |
| InChIKey | GEIBFSAABSZMTF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|