C19H29NO — CID 64922351
3-[(3-ethyl-2-methylcyclopentyl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 64922351) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-[(3-ethyl-2-methylcyclopentyl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 3-[(3-ethyl-2-methylcyclopentyl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 64922351 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 3-[(3-ethyl-2-methylcyclopentyl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | CCC1CCC(NC2CC(C)c3c(C)ccc(O)c32)C1C |
| InChI | InChI=1S/C19H29NO/c1-5-14-7-8-15(13(14)4)20-16-10-12(3)18-11(2)6-9-17(21)19(16)18/h6,9,12-16,20-21H,5,7-8,10H2,1-4H3 |
| InChIKey | QHCOGBYEOODGSI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|