C17H24N2 — CID 64926161
9-(2,3-dihydro-1H-inden-5-yl)-6,9-diazaspiro[4.5]decane (PubChem CID 64926161) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 9-(2,3-dihydro-1H-inden-5-yl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 9-(2,3-dihydro-1H-inden-5-yl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64926161 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 9-(2,3-dihydro-1H-inden-5-yl)-6,9-diazaspiro[4.5]decane |
| SMILES | c1cc2c(cc1N1CCNC3(CCCC3)C1)CCC2 |
| InChI | InChI=1S/C17H24N2/c1-2-9-17(8-1)13-19(11-10-18-17)16-7-6-14-4-3-5-15(14)12-16/h6-7,12,18H,1-5,8-11,13H2 |
| InChIKey | QREJMLAJBNHTJL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|