C15H19Cl3N2 — CID 64926469
4-(2,4,5-trichlorophenyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 64926469) has the molecular formula C15H19Cl3N2 and a molecular weight of 333.69 g/mol. Its IUPAC name is 4-(2,4,5-trichlorophenyl)-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-(2,4,5-trichlorophenyl)-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64926469 |
| Molecular Formula | C15H19Cl3N2 |
| Molecular Weight | 333.69 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-(2,4,5-trichlorophenyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | Clc1cc(Cl)c(N2CCNC3(CCCCC3)C2)cc1Cl |
| InChI | InChI=1S/C15H19Cl3N2/c16-11-8-13(18)14(9-12(11)17)20-7-6-19-15(10-20)4-2-1-3-5-15/h8-9,19H,1-7,10H2 |
| InChIKey | VFQYEOOPRPWVLV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|