C11H16N2O3 — CID 64928484
N-[(2-hydroxycyclohexyl)methyl]-1,2-oxazole-5-carboxamide (PubChem CID 64928484) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[(2-hydroxycyclohexyl)methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(2-hydroxycyclohexyl)methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 64928484 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[(2-hydroxycyclohexyl)methyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCC1CCCCC1O)c1ccno1 |
| InChI | InChI=1S/C11H16N2O3/c14-9-4-2-1-3-8(9)7-12-11(15)10-5-6-13-16-10/h5-6,8-9,14H,1-4,7H2,(H,12,15) |
| InChIKey | SMTXMDPFFZXSNB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |