C19H32N2 — CID 64930058
1-(4-ethylphenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine (PubChem CID 64930058) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine.
| Compound Name | 1-(4-ethylphenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64930058 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-(4-ethylphenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine |
| SMILES | CCc1ccc(N2CC(CC(C)C)NCC2C(C)C)cc1 |
| InChI | InChI=1S/C19H32N2/c1-6-16-7-9-18(10-8-16)21-13-17(11-14(2)3)20-12-19(21)15(4)5/h7-10,14-15,17,19-20H,6,11-13H2,1-5H3 |
| InChIKey | LGZYHWNMSGMZQO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|