C17H26Br2N2 — CID 64936125
1-(2,5-dibromophenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine (PubChem CID 64936125) has the molecular formula C17H26Br2N2 and a molecular weight of 418.22 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine.
| Compound Name | 1-(2,5-dibromophenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64936125 |
| Molecular Formula | C17H26Br2N2 |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-(2,5-dibromophenyl)-5-(2-methylpropyl)-2-propan-2-ylpiperazine |
| SMILES | CC(C)CC1CN(c2cc(Br)ccc2Br)C(C(C)C)CN1 |
| InChI | InChI=1S/C17H26Br2N2/c1-11(2)7-14-10-21(17(9-20-14)12(3)4)16-8-13(18)5-6-15(16)19/h5-6,8,11-12,14,17,20H,7,9-10H2,1-4H3 |
| InChIKey | KMNNYJNZTQHZPT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |