C15H22Br2N2 — CID 64946822
1-(2,4-dibromophenyl)-2-methyl-5-(2-methylpropyl)piperazine (PubChem CID 64946822) has the molecular formula C15H22Br2N2 and a molecular weight of 390.16 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-methyl-5-(2-methylpropyl)piperazine.
| Compound Name | 1-(2,4-dibromophenyl)-2-methyl-5-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 64946822 |
| Molecular Formula | C15H22Br2N2 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-methyl-5-(2-methylpropyl)piperazine |
| SMILES | CC(C)CC1CN(c2ccc(Br)cc2Br)C(C)CN1 |
| InChI | InChI=1S/C15H22Br2N2/c1-10(2)6-13-9-19(11(3)8-18-13)15-5-4-12(16)7-14(15)17/h4-5,7,10-11,13,18H,6,8-9H2,1-3H3 |
| InChIKey | FYRRZNUUIVCRTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |