About 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine
1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine (PubChem CID 64930171) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine.
Molecular Properties
| Compound Name | 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine |
| PubChem CID | 64930171 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine |
| SMILES | CCOc1ccc(N2CC(C)(CC)NCC2CC)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-5-14-12-18-17(4,6-2)13-19(14)15-8-10-16(11-9-15)20-7-3/h8-11,14,18H,5-7,12-13H2,1-4H3 |
| InChIKey | AQGDHXOQWGPPTL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine?
The IUPAC name of 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine (CID 64930171) is 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine.
What is the SMILES notation for 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine?
The canonical SMILES for 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine is CCOc1ccc(N2CC(C)(CC)NCC2CC)cc1.
What is the InChIKey of 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine?
The InChIKey is AQGDHXOQWGPPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c1-5-14-12-18-17(4,6-2)13-19(14)15-8-10-16(11-9-15)20-7-3/h8-11,14,18H,5-7,12-13H2,1-4H3.
What are the key properties of 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine?
1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine has a molecular weight of 276.42 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxyphenyl)-2,5-diethyl-5-methylpiperazine is sourced from PubChem (CID 64930171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).