C17H24N2 — CID 64933982
5,5-diethyl-2-phenyl-1-prop-2-ynylpiperazine (PubChem CID 64933982) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 5,5-diethyl-2-phenyl-1-prop-2-ynylpiperazine.
| Compound Name | 5,5-diethyl-2-phenyl-1-prop-2-ynylpiperazine |
|---|---|
| PubChem CID | 64933982 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 5,5-diethyl-2-phenyl-1-prop-2-ynylpiperazine |
| SMILES | C#CCN1CC(CC)(CC)NCC1c1ccccc1 |
| InChI | InChI=1S/C17H24N2/c1-4-12-19-14-17(5-2,6-3)18-13-16(19)15-10-8-7-9-11-15/h1,7-11,16,18H,5-6,12-14H2,2-3H3 |
| InChIKey | QYMUGPSNOIVCKU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|