C18H24N2 — CID 64939513
9-but-3-ynyl-8-phenyl-6,9-diazaspiro[4.5]decane (PubChem CID 64939513) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 9-but-3-ynyl-8-phenyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 9-but-3-ynyl-8-phenyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64939513 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 9-but-3-ynyl-8-phenyl-6,9-diazaspiro[4.5]decane |
| SMILES | C#CCCN1CC2(CCCC2)NCC1c1ccccc1 |
| InChI | InChI=1S/C18H24N2/c1-2-3-13-20-15-18(11-7-8-12-18)19-14-17(20)16-9-5-4-6-10-16/h1,4-6,9-10,17,19H,3,7-8,11-15H2 |
| InChIKey | URXJELPRWADLOI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|