C17H25FN2 — CID 80696882
8-benzyl-9-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 80696882) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 8-benzyl-9-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-benzyl-9-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 80696882 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 8-benzyl-9-(2-fluoroethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | FCCN1CC2(CCCC2)NCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H25FN2/c18-10-11-20-14-17(8-4-5-9-17)19-13-16(20)12-15-6-2-1-3-7-15/h1-3,6-7,16,19H,4-5,8-14H2 |
| InChIKey | YIBDXIWGLQOIGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |