C13H18F2N2 — CID 64934794
1-(2,6-difluorophenyl)-5-ethyl-2-methylpiperazine (PubChem CID 64934794) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-5-ethyl-2-methylpiperazine.
| Compound Name | 1-(2,6-difluorophenyl)-5-ethyl-2-methylpiperazine |
|---|---|
| PubChem CID | 64934794 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-5-ethyl-2-methylpiperazine |
| SMILES | CCC1CN(c2c(F)cccc2F)C(C)CN1 |
| InChI | InChI=1S/C13H18F2N2/c1-3-10-8-17(9(2)7-16-10)13-11(14)5-4-6-12(13)15/h4-6,9-10,16H,3,7-8H2,1-2H3 |
| InChIKey | ZXLSDGFSRJJELF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |