C18H21IN2 — CID 64935115
1-(2-iodophenyl)-5,5-dimethyl-2-phenylpiperazine (PubChem CID 64935115) has the molecular formula C18H21IN2 and a molecular weight of 392.28 g/mol. Its IUPAC name is 1-(2-iodophenyl)-5,5-dimethyl-2-phenylpiperazine.
| Compound Name | 1-(2-iodophenyl)-5,5-dimethyl-2-phenylpiperazine |
|---|---|
| PubChem CID | 64935115 |
| Molecular Formula | C18H21IN2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(2-iodophenyl)-5,5-dimethyl-2-phenylpiperazine |
| SMILES | CC1(C)CN(c2ccccc2I)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C18H21IN2/c1-18(2)13-21(16-11-7-6-10-15(16)19)17(12-20-18)14-8-4-3-5-9-14/h3-11,17,20H,12-13H2,1-2H3 |
| InChIKey | BSBOAMQTSYIPJV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|