C15H25N3 — CID 106760852
N,N-dimethyl-2-(2,5,5-trimethylpiperazin-1-yl)aniline (PubChem CID 106760852) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N,N-dimethyl-2-(2,5,5-trimethylpiperazin-1-yl)aniline.
| Compound Name | N,N-dimethyl-2-(2,5,5-trimethylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 106760852 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N,N-dimethyl-2-(2,5,5-trimethylpiperazin-1-yl)aniline |
| SMILES | CC1CNC(C)(C)CN1c1ccccc1N(C)C |
| InChI | InChI=1S/C15H25N3/c1-12-10-16-15(2,3)11-18(12)14-9-7-6-8-13(14)17(4)5/h6-9,12,16H,10-11H2,1-5H3 |
| InChIKey | LUXIQCWRCXNZHO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |