C15H21Cl3N2 — CID 64937128
2-ethyl-5-propan-2-yl-1-(2,4,5-trichlorophenyl)piperazine (PubChem CID 64937128) has the molecular formula C15H21Cl3N2 and a molecular weight of 335.71 g/mol. Its IUPAC name is 2-ethyl-5-propan-2-yl-1-(2,4,5-trichlorophenyl)piperazine.
| Compound Name | 2-ethyl-5-propan-2-yl-1-(2,4,5-trichlorophenyl)piperazine |
|---|---|
| PubChem CID | 64937128 |
| Molecular Formula | C15H21Cl3N2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-ethyl-5-propan-2-yl-1-(2,4,5-trichlorophenyl)piperazine |
| SMILES | CCC1CNC(C(C)C)CN1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl3N2/c1-4-10-7-19-14(9(2)3)8-20(10)15-6-12(17)11(16)5-13(15)18/h5-6,9-10,14,19H,4,7-8H2,1-3H3 |
| InChIKey | DJTJFGBZDXUEBL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|