C16H24ClIN2 — CID 107640020
5-butan-2-yl-1-(4-chloro-2-iodophenyl)-2-ethylpiperazine (PubChem CID 107640020) has the molecular formula C16H24ClIN2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 5-butan-2-yl-1-(4-chloro-2-iodophenyl)-2-ethylpiperazine.
| Compound Name | 5-butan-2-yl-1-(4-chloro-2-iodophenyl)-2-ethylpiperazine |
|---|---|
| PubChem CID | 107640020 |
| Molecular Formula | C16H24ClIN2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 5-butan-2-yl-1-(4-chloro-2-iodophenyl)-2-ethylpiperazine |
| SMILES | CCC(C)C1CN(c2ccc(Cl)cc2I)C(CC)CN1 |
| InChI | InChI=1S/C16H24ClIN2/c1-4-11(3)15-10-20(13(5-2)9-19-15)16-7-6-12(17)8-14(16)18/h6-8,11,13,15,19H,4-5,9-10H2,1-3H3 |
| InChIKey | LQHZMBYXKIJYCG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|