C18H30N2 — CID 64954497
5-butan-2-yl-1-(2,3-dimethylphenyl)-2-ethylpiperazine (PubChem CID 64954497) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 5-butan-2-yl-1-(2,3-dimethylphenyl)-2-ethylpiperazine.
| Compound Name | 5-butan-2-yl-1-(2,3-dimethylphenyl)-2-ethylpiperazine |
|---|---|
| PubChem CID | 64954497 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 5-butan-2-yl-1-(2,3-dimethylphenyl)-2-ethylpiperazine |
| SMILES | CCC(C)C1CN(c2cccc(C)c2C)C(CC)CN1 |
| InChI | InChI=1S/C18H30N2/c1-6-13(3)17-12-20(16(7-2)11-19-17)18-10-8-9-14(4)15(18)5/h8-10,13,16-17,19H,6-7,11-12H2,1-5H3 |
| InChIKey | ABVGCTVNUOYODI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |