C16H24F2N2O — CID 64938260
5-butan-2-yl-1-[4-(difluoromethoxy)phenyl]-2-methylpiperazine (PubChem CID 64938260) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 5-butan-2-yl-1-[4-(difluoromethoxy)phenyl]-2-methylpiperazine.
| Compound Name | 5-butan-2-yl-1-[4-(difluoromethoxy)phenyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 64938260 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 5-butan-2-yl-1-[4-(difluoromethoxy)phenyl]-2-methylpiperazine |
| SMILES | CCC(C)C1CN(c2ccc(OC(F)F)cc2)C(C)CN1 |
| InChI | InChI=1S/C16H24F2N2O/c1-4-11(2)15-10-20(12(3)9-19-15)13-5-7-14(8-6-13)21-16(17)18/h5-8,11-12,15-16,19H,4,9-10H2,1-3H3 |
| InChIKey | TWVOJAKSANOMNY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|