About 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole
4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole (PubChem CID 64942380) has the molecular formula C16H27N3S
and a molecular weight of 293.48 g/mol. Its IUPAC name is 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole |
| PubChem CID | 64942380 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole |
| SMILES | CC(C)C1CNC2(CCCCC2)CN1Cc1cscn1 |
| InChI | InChI=1S/C16H27N3S/c1-13(2)15-8-18-16(6-4-3-5-7-16)11-19(15)9-14-10-20-12-17-14/h10,12-13,15,18H,3-9,11H2,1-2H3 |
| InChIKey | RYGPKZMWQINESK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole?
The IUPAC name of 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole (CID 64942380) is 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole?
The canonical SMILES for 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole is CC(C)C1CNC2(CCCCC2)CN1Cc1cscn1.
What is the InChIKey of 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole?
The InChIKey is RYGPKZMWQINESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3S/c1-13(2)15-8-18-16(6-4-3-5-7-16)11-19(15)9-14-10-20-12-17-14/h10,12-13,15,18H,3-9,11H2,1-2H3.
What are the key properties of 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole?
4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole has a molecular weight of 293.48 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-propan-2-yl-1,4-diazaspiro[5.5]undecan-4-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 64942380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).