C15H24N2S — CID 64943561
3-ethyl-3-methyl-1-(3-methylsulfanylphenyl)-1,4-diazepane (PubChem CID 64943561) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-(3-methylsulfanylphenyl)-1,4-diazepane.
| Compound Name | 3-ethyl-3-methyl-1-(3-methylsulfanylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64943561 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-ethyl-3-methyl-1-(3-methylsulfanylphenyl)-1,4-diazepane |
| SMILES | CCC1(C)CN(c2cccc(SC)c2)CCCN1 |
| InChI | InChI=1S/C15H24N2S/c1-4-15(2)12-17(10-6-9-16-15)13-7-5-8-14(11-13)18-3/h5,7-8,11,16H,4,6,9-10,12H2,1-3H3 |
| InChIKey | CMFSFCYZAZLJKN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |