C16H25ClN2 — CID 64943637
1-[1-(2-chlorophenyl)ethyl]-3-propyl-1,4-diazepane (PubChem CID 64943637) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-propyl-1,4-diazepane.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943637 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-propyl-1,4-diazepane |
| SMILES | CCCC1CN(C(C)c2ccccc2Cl)CCCN1 |
| InChI | InChI=1S/C16H25ClN2/c1-3-7-14-12-19(11-6-10-18-14)13(2)15-8-4-5-9-16(15)17/h4-5,8-9,13-14,18H,3,6-7,10-12H2,1-2H3 |
| InChIKey | AYSFTWYUIQKHQH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |