C12H24N2O2 — CID 64944195
1-(1,4-dioxan-2-ylmethyl)-3,3-dimethyl-1,4-diazepane (PubChem CID 64944195) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-3,3-dimethyl-1,4-diazepane.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-3,3-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64944195 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-3,3-dimethyl-1,4-diazepane |
| SMILES | CC1(C)CN(CC2COCCO2)CCCN1 |
| InChI | InChI=1S/C12H24N2O2/c1-12(2)10-14(5-3-4-13-12)8-11-9-15-6-7-16-11/h11,13H,3-10H2,1-2H3 |
| InChIKey | QWGDOAVMDITRAB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |