About 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane
1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane (PubChem CID 64944587) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane |
| PubChem CID | 64944587 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane |
| SMILES | CCC1CN(CC2COCCO2)CCCN1 |
| InChI | InChI=1S/C12H24N2O2/c1-2-11-8-14(5-3-4-13-11)9-12-10-15-6-7-16-12/h11-13H,2-10H2,1H3 |
| InChIKey | AOEDTNUIWXXUOD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane?
The IUPAC name of 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane (CID 64944587) is 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane.
What is the SMILES notation for 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane?
The canonical SMILES for 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane is CCC1CN(CC2COCCO2)CCCN1.
What is the InChIKey of 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane?
The InChIKey is AOEDTNUIWXXUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-2-11-8-14(5-3-4-13-11)9-12-10-15-6-7-16-12/h11-13H,2-10H2,1H3.
What are the key properties of 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane?
1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane has a molecular weight of 228.34 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxan-2-ylmethyl)-3-ethyl-1,4-diazepane is sourced from PubChem (CID 64944587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).