C16H25ClN2S — CID 64947386
1-[1-(5-chlorothiophen-2-yl)ethyl]-5-cyclopropyl-2-propan-2-ylpiperazine (PubChem CID 64947386) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-5-cyclopropyl-2-propan-2-ylpiperazine.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-5-cyclopropyl-2-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64947386 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-5-cyclopropyl-2-propan-2-ylpiperazine |
| SMILES | CC(C)C1CNC(C2CC2)CN1C(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H25ClN2S/c1-10(2)14-8-18-13(12-4-5-12)9-19(14)11(3)15-6-7-16(17)20-15/h6-7,10-14,18H,4-5,8-9H2,1-3H3 |
| InChIKey | QFWCIHLBASAMQB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |