C12H19ClN2S — CID 63862940
1-[1-(5-chlorothiophen-2-yl)ethyl]-3,5-dimethylpiperazine (PubChem CID 63862940) has the molecular formula C12H19ClN2S and a molecular weight of 258.82 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3,5-dimethylpiperazine.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 63862940 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3,5-dimethylpiperazine |
| SMILES | CC1CN(C(C)c2ccc(Cl)s2)CC(C)N1 |
| InChI | InChI=1S/C12H19ClN2S/c1-8-6-15(7-9(2)14-8)10(3)11-4-5-12(13)16-11/h4-5,8-10,14H,6-7H2,1-3H3 |
| InChIKey | DZNAZNGWGVBDRG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |