C12H16ClNO2S — CID 65064411
1-[1-(5-chlorothiophen-2-yl)ethyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 65064411) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65064411 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC(c1ccc(Cl)s1)N1CCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-8(9-3-4-10(13)17-9)14-6-5-12(2,7-14)11(15)16/h3-4,8H,5-7H2,1-2H3,(H,15,16) |
| InChIKey | AQQZTZOFSQPEEO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |