C13H17FN4O2 — CID 64951471
3-fluoro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-4-carboxamide (PubChem CID 64951471) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 64951471 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-fluoro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-4-carboxamide |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)c1ccncc1F |
| InChI | InChI=1S/C13H17FN4O2/c1-17(9-12(19)18-6-4-15-5-7-18)13(20)10-2-3-16-8-11(10)14/h2-3,8,15H,4-7,9H2,1H3 |
| InChIKey | DBRQPJVYTZFWRJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |