C13H19Cl3N4O2 — CID 119454701
5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-2-carboxamide;dihydrochloride (PubChem CID 119454701) has the molecular formula C13H19Cl3N4O2 and a molecular weight of 369.68 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-2-carboxamide;dihydrochloride.
| Compound Name | 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119454701 |
| Molecular Formula | C13H19Cl3N4O2 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyridine-2-carboxamide;dihydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)c1ccc(Cl)cn1.Cl.Cl |
| InChI | InChI=1S/C13H17ClN4O2.2ClH/c1-17(9-12(19)18-6-4-15-5-7-18)13(20)11-3-2-10(14)8-16-11;;/h2-3,8,15H,4-7,9H2,1H3;2*1H |
| InChIKey | QKAPTSILJIPARY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |